Product list
Contact us
Shanghai Bojing Chemical Co.,Ltd.
Domestic contact:Manager Yin
Mobile：+86-13681836088 +86-18930309966
Tel：+86-21-37199966
Fax：+86-21-67118600
Foreign contact:Manager Zhang
Tel：+86-21-37122233
Fax：+86-21-37597788
E-mail：bj@bj-chem.com
Product
| Product name | Acetone |
| CAS RN | 67-64-1 |
| Assay | 99% |
| Alias | 2-Propanone;dimethylketal;Dimethyl ketone;beta-ketopropane;chevron acetone;ketone propane;Methyl ketone;Propanone;pyroacetic acid;pyroacetic ether; |
| English name | Acetone |
| Alias | 2-Propanone;dimethylketal;Dimethyl ketone;beta-ketopropane;chevron acetone;ketone propane;Methyl ketone;Propanone;pyroacetic acid;pyroacetic ether; |
| EINECS No. | 200-662-2 |
| Molecular formula | C3H6O |
| Molecular weight | 58.08 |
| InChI | InChI=1/C3H6O/c1-3(2)4/h1-2H3 |
| Density | 0.79 |
| Melting point | -95℃ |
| Boiling point | 56℃ |
| Flash point | -20℃ |
| Solubility | soluble |
| Appearance and property | Colorless and transparent liquid with aromatic odor. It is easily volatile. |
| Melting point(℃) | -94.6 |
| Boiling point(℃) | 56.5 |
| Relative density (water=1) | 0.80 |
| Relative vapor density (air=1) | 2.00 |
| Saturated vapor pressure (kPa) | 53.32(39.5℃) |
| Heat of combustion (kJ/mol) | 1788.7 |
| Critical temperature (℃) | 235.5 |
| Critical pressure (MPa) | 4.72 |
| Log Koc of octanol/moisture partition coefficient | -0.24 |
| Flash point(℃) | -20 |
| Ignition temperature (℃) | 465 |
| Upper explosive limit %(V/V) | 2.5 |
| Lower explosive limit %(V/V) | 13.0 |
| Solubility | Soluble in water, ethyl alcohol, diethyl ether, trichloromethane, oils, hydrocarbon, and many organic solvents. |
